C11H25NO — CID 65175065
N-(3-ethoxypropyl)-2,3-dimethylbutan-1-amine (PubChem CID 65175065) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2,3-dimethylbutan-1-amine.
| Compound Name | N-(3-ethoxypropyl)-2,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 65175065 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | N-(3-ethoxypropyl)-2,3-dimethylbutan-1-amine |
| SMILES | CCOCCCNCC(C)C(C)C |
| InChI | InChI=1S/C11H25NO/c1-5-13-8-6-7-12-9-11(4)10(2)3/h10-12H,5-9H2,1-4H3 |
| InChIKey | AHHZFLMSLSRYIH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|