C13H30N2O2 — CID 62567966
1-N-(3-ethoxypropyl)-2-N-(1-methoxypropan-2-yl)-2-N-methylpropane-1,2-diamine (PubChem CID 62567966) has the molecular formula C13H30N2O2 and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-N-(3-ethoxypropyl)-2-N-(1-methoxypropan-2-yl)-2-N-methylpropane-1,2-diamine.
| Compound Name | 1-N-(3-ethoxypropyl)-2-N-(1-methoxypropan-2-yl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 62567966 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1-N-(3-ethoxypropyl)-2-N-(1-methoxypropan-2-yl)-2-N-methylpropane-1,2-diamine |
| SMILES | CCOCCCNCC(C)N(C)C(C)COC |
| InChI | InChI=1S/C13H30N2O2/c1-6-17-9-7-8-14-10-12(2)15(4)13(3)11-16-5/h12-14H,6-11H2,1-5H3 |
| InChIKey | BRXXOOMLRIGRTR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|