C14H30N2S — CID 112666260
N-cyclohexyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)propane-1,3-diamine (PubChem CID 112666260) has the molecular formula C14H30N2S and a molecular weight of 258.47 g/mol. Its IUPAC name is N-cyclohexyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)propane-1,3-diamine.
| Compound Name | N-cyclohexyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 112666260 |
| Molecular Formula | C14H30N2S |
| Molecular Weight | 258.47 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-cyclohexyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)propane-1,3-diamine |
| SMILES | CSCC(C)N(C)CCCNC1CCCCC1 |
| InChI | InChI=1S/C14H30N2S/c1-13(12-17-3)16(2)11-7-10-15-14-8-5-4-6-9-14/h13-15H,4-12H2,1-3H3 |
| InChIKey | VKVCCPSVDZHPFH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|