C13H28N2S — CID 112665952
N-cyclopropyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)pentane-1,5-diamine (PubChem CID 112665952) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)pentane-1,5-diamine.
| Compound Name | N-cyclopropyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 112665952 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | N-cyclopropyl-N'-methyl-N'-(1-methylsulfanylpropan-2-yl)pentane-1,5-diamine |
| SMILES | CSCC(C)N(C)CCCCCNC1CC1 |
| InChI | InChI=1S/C13H28N2S/c1-12(11-16-3)15(2)10-6-4-5-9-14-13-7-8-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | CUNZLONWYGJCCE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|