C16H22N2O4 — CID 11266759
(2S,3R,4S)-1-benzoyl-N-butyl-3,4-dihydroxypyrrolidine-2-carboxamide (PubChem CID 11266759) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S,3R,4S)-1-benzoyl-N-butyl-3,4-dihydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S)-1-benzoyl-N-butyl-3,4-dihydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11266759 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2S,3R,4S)-1-benzoyl-N-butyl-3,4-dihydroxypyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1[C@@H](O)[C@@H](O)CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-2-3-9-17-15(21)13-14(20)12(19)10-18(13)16(22)11-7-5-4-6-8-11/h4-8,12-14,19-20H,2-3,9-10H2,1H3,(H,17,21)/t12-,13-,14-/m0/s1 |
| InChIKey | PQOYKGHYALMGNB-IHRRRGAJSA-N |
| XLogP | 0.15 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|