C19H27N3O4 — CID 11451279
(3aR,4S,6aS)-2,2-dimethyl-N-pentyl-5-(pyridine-3-carbonyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11451279) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is (3aR,4S,6aS)-2,2-dimethyl-N-pentyl-5-(pyridine-3-carbonyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,4S,6aS)-2,2-dimethyl-N-pentyl-5-(pyridine-3-carbonyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11451279 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (3aR,4S,6aS)-2,2-dimethyl-N-pentyl-5-(pyridine-3-carbonyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2CN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C19H27N3O4/c1-4-5-6-10-21-17(23)15-16-14(25-19(2,3)26-16)12-22(15)18(24)13-8-7-9-20-11-13/h7-9,11,14-16H,4-6,10,12H2,1-3H3,(H,21,23)/t14-,15-,16-/m0/s1 |
| InChIKey | QCNUCWDXTIHMDW-JYJNAYRXSA-N |
| XLogP | 1.73 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|