C34H47N3O3 — CID 162176760
N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 162176760) has the molecular formula C34H47N3O3 and a molecular weight of 545.77 g/mol. Its IUPAC name is N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 162176760 |
| Molecular Formula | C34H47N3O3 |
| Molecular Weight | 545.77 g/mol |
| Exact Mass | 545.36 |
| IUPAC Name | N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)CCCNC(=O)C1CCCN1C(=O)c1cccnc1 |
| InChI | InChI=1S/C34H47N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-31(38)24-20-27-36-33(39)32-25-21-28-37(32)34(40)30-22-19-26-35-29-30/h3-4,6-7,9-10,12-13,15-16,19,22,26,29,32H,2,5,8,11,14,17-18,20-21,23-25,27-28H2,1H3,(H,36,39)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | SKRMLGZBGGUTMU-JLNKQSITSA-N |
| XLogP | 7.07 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|