C34H49N3O3S — CID 162176757
(2S)-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide;sulfane (PubChem CID 162176757) has the molecular formula C34H49N3O3S and a molecular weight of 579.85 g/mol. Its IUPAC name is (2S)-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide;sulfane.
| Compound Name | (2S)-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide;sulfane |
|---|---|
| PubChem CID | 162176757 |
| Molecular Formula | C34H49N3O3S |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.35 |
| IUPAC Name | (2S)-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]-1-(pyridine-3-carbonyl)pyrrolidine-2-carboxamide;sulfane |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)CCCNC(=O)[C@@H]1CCCN1C(=O)c1cccnc1.S |
| InChI | InChI=1S/C34H47N3O3.H2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-31(38)24-20-27-36-33(39)32-25-21-28-37(32)34(40)30-22-19-26-35-29-30;/h3-4,6-7,9-10,12-13,15-16,19,22,26,29,32H,2,5,8,11,14,17-18,20-21,23-25,27-28H2,1H3,(H,36,39);1H2/b4-3-,7-6-,10-9-,13-12-,16-15-;/t32-;/m0./s1 |
| InChIKey | ZOMKRSGRAWYXHC-BQUINDOGSA-N |
| XLogP | 7.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|