C27H36N4O3S — CID 60608676
N-[3-[3-(hexylcarbamoyl)piperidine-1-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyridine-3-carboxamide (PubChem CID 60608676) has the molecular formula C27H36N4O3S and a molecular weight of 496.68 g/mol. Its IUPAC name is N-[3-[3-(hexylcarbamoyl)piperidine-1-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-[3-(hexylcarbamoyl)piperidine-1-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60608676 |
| Molecular Formula | C27H36N4O3S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[3-[3-(hexylcarbamoyl)piperidine-1-carbonyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyridine-3-carboxamide |
| SMILES | CCCCCCNC(=O)C1CCCN(C(=O)c2c(NC(=O)c3cccnc3)sc3c2CCCC3)C1 |
| InChI | InChI=1S/C27H36N4O3S/c1-2-3-4-7-15-29-24(32)20-11-9-16-31(18-20)27(34)23-21-12-5-6-13-22(21)35-26(23)30-25(33)19-10-8-14-28-17-19/h8,10,14,17,20H,2-7,9,11-13,15-16,18H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | CFYHAVJYUARKBK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|