C21H30N2O4 — CID 60608356
methyl 4-[3-(hexylcarbamoyl)piperidine-1-carbonyl]benzoate (PubChem CID 60608356) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl 4-[3-(hexylcarbamoyl)piperidine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[3-(hexylcarbamoyl)piperidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 60608356 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | methyl 4-[3-(hexylcarbamoyl)piperidine-1-carbonyl]benzoate |
| SMILES | CCCCCCNC(=O)C1CCCN(C(=O)c2ccc(C(=O)OC)cc2)C1 |
| InChI | InChI=1S/C21H30N2O4/c1-3-4-5-6-13-22-19(24)18-8-7-14-23(15-18)20(25)16-9-11-17(12-10-16)21(26)27-2/h9-12,18H,3-8,13-15H2,1-2H3,(H,22,24) |
| InChIKey | YIBLPWOJMYUCKZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|