C17H25N3O2 — CID 97027555
(2S,3S)-N-hexyl-1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide (PubChem CID 97027555) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2S,3S)-N-hexyl-1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-N-hexyl-1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97027555 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2S,3S)-N-hexyl-1-methyl-5-oxo-2-pyridin-3-ylpyrrolidine-3-carboxamide |
| SMILES | CCCCCCNC(=O)[C@H]1CC(=O)N(C)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-4-5-6-10-19-17(22)14-11-15(21)20(2)16(14)13-8-7-9-18-12-13/h7-9,12,14,16H,3-6,10-11H2,1-2H3,(H,19,22)/t14-,16+/m0/s1 |
| InChIKey | FYGPKFTTYUVHCF-GOEBONIOSA-N |
| XLogP | 2.30 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|