C16H21FN2O2 — CID 95740531
(2S,3S)-N-butyl-2-(3-fluorophenyl)-1-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 95740531) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is (2S,3S)-N-butyl-2-(3-fluorophenyl)-1-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-N-butyl-2-(3-fluorophenyl)-1-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95740531 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2S,3S)-N-butyl-2-(3-fluorophenyl)-1-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CC(=O)N(C)[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O2/c1-3-4-8-18-16(21)13-10-14(20)19(2)15(13)11-6-5-7-12(17)9-11/h5-7,9,13,15H,3-4,8,10H2,1-2H3,(H,18,21)/t13-,15+/m0/s1 |
| InChIKey | XMZCHHLHFXQPCZ-DZGCQCFKSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|