C16H21FN2O3 — CID 95739924
(2S,3R)-N-butyl-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide (PubChem CID 95739924) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is (2S,3R)-N-butyl-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide.
| Compound Name | (2S,3R)-N-butyl-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95739924 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2S,3R)-N-butyl-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1OCC(=O)N(C)[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O3/c1-3-4-8-18-16(21)15-14(19(2)13(20)10-22-15)11-6-5-7-12(17)9-11/h5-7,9,14-15H,3-4,8,10H2,1-2H3,(H,18,21)/t14-,15+/m1/s1 |
| InChIKey | MLMPOFCRZQROFV-CABCVRRESA-N |
| XLogP | 1.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|