C17H24N2O3 — CID 97457343
(2S,3S)-N-butyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide (PubChem CID 97457343) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S,3S)-N-butyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide.
| Compound Name | (2S,3S)-N-butyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 97457343 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2S,3S)-N-butyl-4-methyl-3-(4-methylphenyl)-5-oxomorpholine-2-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1OCC(=O)N(C)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24N2O3/c1-4-5-10-18-17(21)16-15(19(3)14(20)11-22-16)13-8-6-12(2)7-9-13/h6-9,15-16H,4-5,10-11H2,1-3H3,(H,18,21)/t15-,16-/m0/s1 |
| InChIKey | QIINWIFLQMBCSC-HOTGVXAUSA-N |
| XLogP | 1.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|