C16H21FN2O4 — CID 71689508
3-(3-fluorophenyl)-N-(3-methoxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide (PubChem CID 71689508) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(3-methoxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-(3-methoxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 71689508 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(3-methoxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide |
| SMILES | COCCCNC(=O)C1OCC(=O)N(C)C1c1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN2O4/c1-19-13(20)10-23-15(16(21)18-7-4-8-22-2)14(19)11-5-3-6-12(17)9-11/h3,5-6,9,14-15H,4,7-8,10H2,1-2H3,(H,18,21) |
| InChIKey | PBFZHCPCSPGFSA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|