C15H19FN2O4 — CID 71689506
3-(3-fluorophenyl)-N-(3-hydroxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide (PubChem CID 71689506) has the molecular formula C15H19FN2O4 and a molecular weight of 310.33 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-(3-hydroxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide.
| Compound Name | 3-(3-fluorophenyl)-N-(3-hydroxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 71689506 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-(3-fluorophenyl)-N-(3-hydroxypropyl)-4-methyl-5-oxomorpholine-2-carboxamide |
| SMILES | CN1C(=O)COC(C(=O)NCCCO)C1c1cccc(F)c1 |
| InChI | InChI=1S/C15H19FN2O4/c1-18-12(20)9-22-14(15(21)17-6-3-7-19)13(18)10-4-2-5-11(16)8-10/h2,4-5,8,13-14,19H,3,6-7,9H2,1H3,(H,17,21) |
| InChIKey | XXSPPEVCEZCFFH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|