C17H23FN2O4 — CID 95739962
(2S,3S)-N-(3-ethoxypropyl)-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide (PubChem CID 95739962) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is (2S,3S)-N-(3-ethoxypropyl)-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide.
| Compound Name | (2S,3S)-N-(3-ethoxypropyl)-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95739962 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2S,3S)-N-(3-ethoxypropyl)-3-(3-fluorophenyl)-4-methyl-5-oxomorpholine-2-carboxamide |
| SMILES | CCOCCCNC(=O)[C@H]1OCC(=O)N(C)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H23FN2O4/c1-3-23-9-5-8-19-17(22)16-15(20(2)14(21)11-24-16)12-6-4-7-13(18)10-12/h4,6-7,10,15-16H,3,5,8-9,11H2,1-2H3,(H,19,22)/t15-,16-/m0/s1 |
| InChIKey | UBEGWSCWENJQBS-HOTGVXAUSA-N |
| XLogP | 1.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|