C15H17ClN2O4 — CID 119177320
3-[[2-(3-chlorophenyl)-1-methyl-5-oxopyrrolidine-3-carbonyl]amino]propanoic acid (PubChem CID 119177320) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-1-methyl-5-oxopyrrolidine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[2-(3-chlorophenyl)-1-methyl-5-oxopyrrolidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119177320 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-1-methyl-5-oxopyrrolidine-3-carbonyl]amino]propanoic acid |
| SMILES | CN1C(=O)CC(C(=O)NCCC(=O)O)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O4/c1-18-12(19)8-11(15(22)17-6-5-13(20)21)14(18)9-3-2-4-10(16)7-9/h2-4,7,11,14H,5-6,8H2,1H3,(H,17,22)(H,20,21) |
| InChIKey | FADARDVIQCWORZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |