C12H21N3O2 — CID 112669747
methyl 2-(3-ethyl-1-methylpyrazol-4-yl)-2-(propan-2-ylamino)acetate (PubChem CID 112669747) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is methyl 2-(3-ethyl-1-methylpyrazol-4-yl)-2-(propan-2-ylamino)acetate.
| Compound Name | methyl 2-(3-ethyl-1-methylpyrazol-4-yl)-2-(propan-2-ylamino)acetate |
|---|---|
| PubChem CID | 112669747 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | methyl 2-(3-ethyl-1-methylpyrazol-4-yl)-2-(propan-2-ylamino)acetate |
| SMILES | CCc1nn(C)cc1C(NC(C)C)C(=O)OC |
| InChI | InChI=1S/C12H21N3O2/c1-6-10-9(7-15(4)14-10)11(12(16)17-5)13-8(2)3/h7-8,11,13H,6H2,1-5H3 |
| InChIKey | YHSHRNHTQQUTMR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |