C12H21N5O — CID 112670057
2-[1-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 112670057) has the molecular formula C12H21N5O and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[1-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 112670057 |
| Molecular Formula | C12H21N5O |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[1-[[(1,3-dimethylpyrazol-4-yl)methylamino]methyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | Cc1nn(C)cc1CNCC1(C/C(N)=N/O)CC1 |
| InChI | InChI=1S/C12H21N5O/c1-9-10(7-17(2)15-9)6-14-8-12(3-4-12)5-11(13)16-18/h7,14,18H,3-6,8H2,1-2H3,(H2,13,16) |
| InChIKey | WEESFDVZWRVPTP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|