C10H16F3N5O — CID 106033812
2-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 106033812) has the molecular formula C10H16F3N5O and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 106033812 |
| Molecular Formula | C10H16F3N5O |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[[(1,5-dimethylpyrazol-4-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | Cc1c(CNCC(C(N)=NO)C(F)(F)F)cnn1C |
| InChI | InChI=1S/C10H16F3N5O/c1-6-7(4-16-18(6)2)3-15-5-8(9(14)17-19)10(11,12)13/h4,8,15,19H,3,5H2,1-2H3,(H2,14,17) |
| InChIKey | BHOXPXYAJOCDFV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|