About 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione
3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione (PubChem CID 112670947) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione |
| PubChem CID | 112670947 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione |
| SMILES | Cc1nn(C)cc1Cn1cc[nH]c1=S |
| InChI | InChI=1S/C9H12N4S/c1-7-8(5-12(2)11-7)6-13-4-3-10-9(13)14/h3-5H,6H2,1-2H3,(H,10,14) |
| InChIKey | ICPBSSMTUVUNTP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione?
The IUPAC name of 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione (CID 112670947) is 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione.
What is the SMILES notation for 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione?
The canonical SMILES for 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione is Cc1nn(C)cc1Cn1cc[nH]c1=S.
What is the InChIKey of 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione?
The InChIKey is ICPBSSMTUVUNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S/c1-7-8(5-12(2)11-7)6-13-4-3-10-9(13)14/h3-5H,6H2,1-2H3,(H,10,14).
What are the key properties of 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione?
3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione has a molecular weight of 208.29 g/mol, XLogP of 1.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-imidazole-2-thione is sourced from PubChem (CID 112670947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).