C11H15N5S — CID 112670982
3-cyclopropyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 112670982) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-cyclopropyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 112670982 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-cyclopropyl-4-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(C)cc1Cn1c(C2CC2)n[nH]c1=S |
| InChI | InChI=1S/C11H15N5S/c1-7-9(5-15(2)14-7)6-16-10(8-3-4-8)12-13-11(16)17/h5,8H,3-4,6H2,1-2H3,(H,13,17) |
| InChIKey | FMGNMILQTMHLHC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|