C8H15N5O2 — CID 112673930
2-[(2-propyl-1,2,4-triazol-3-yl)methylamino]oxyacetamide (PubChem CID 112673930) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[(2-propyl-1,2,4-triazol-3-yl)methylamino]oxyacetamide.
| Compound Name | 2-[(2-propyl-1,2,4-triazol-3-yl)methylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673930 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-[(2-propyl-1,2,4-triazol-3-yl)methylamino]oxyacetamide |
| SMILES | CCCn1ncnc1CNOCC(N)=O |
| InChI | InChI=1S/C8H15N5O2/c1-2-3-13-8(10-6-11-13)4-12-15-5-7(9)14/h6,12H,2-5H2,1H3,(H2,9,14) |
| InChIKey | POPFHXROSMSQBX-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|