C8H13N5O4S — CID 112675174
3-hydrazinyl-N',N'-dimethyl-2-nitrobenzenesulfonohydrazide (PubChem CID 112675174) has the molecular formula C8H13N5O4S and a molecular weight of 275.29 g/mol. Its IUPAC name is 3-hydrazinyl-N',N'-dimethyl-2-nitrobenzenesulfonohydrazide.
| Compound Name | 3-hydrazinyl-N',N'-dimethyl-2-nitrobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 112675174 |
| Molecular Formula | C8H13N5O4S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-hydrazinyl-N',N'-dimethyl-2-nitrobenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1cccc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H13N5O4S/c1-12(2)11-18(16,17)7-5-3-4-6(10-9)8(7)13(14)15/h3-5,10-11H,9H2,1-2H3 |
| InChIKey | NOFKQQIIDBJXRN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|