C10H14N4O5S2 — CID 115992827
[2-nitro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]hydrazine (PubChem CID 115992827) has the molecular formula C10H14N4O5S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is [2-nitro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]hydrazine.
| Compound Name | [2-nitro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 115992827 |
| Molecular Formula | C10H14N4O5S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | [2-nitro-3-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]phenyl]hydrazine |
| SMILES | NNc1cccc(S(=O)(=O)N2CCS(=O)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O5S2/c11-12-8-2-1-3-9(10(8)14(15)16)21(18,19)13-4-6-20(17)7-5-13/h1-3,12H,4-7,11H2 |
| InChIKey | GWAARDCBZDRJKY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|