C11H5BrF3NO — CID 112675508
2-(4-bromo-3-fluorophenoxy)-3,5-difluoropyridine (PubChem CID 112675508) has the molecular formula C11H5BrF3NO and a molecular weight of 304.07 g/mol. Its IUPAC name is 2-(4-bromo-3-fluorophenoxy)-3,5-difluoropyridine.
| Compound Name | 2-(4-bromo-3-fluorophenoxy)-3,5-difluoropyridine |
|---|---|
| PubChem CID | 112675508 |
| Molecular Formula | C11H5BrF3NO |
| Molecular Weight | 304.07 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 2-(4-bromo-3-fluorophenoxy)-3,5-difluoropyridine |
| SMILES | Fc1cnc(Oc2ccc(Br)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C11H5BrF3NO/c12-8-2-1-7(4-9(8)14)17-11-10(15)3-6(13)5-16-11/h1-5H |
| InChIKey | AFHXGPISKUYYJP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.07 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |