C15H13BrClFN2O — CID 65201433
N-[[6-(4-bromo-3-fluorophenoxy)-5-chloro-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 65201433) has the molecular formula C15H13BrClFN2O and a molecular weight of 371.64 g/mol. Its IUPAC name is N-[[6-(4-bromo-3-fluorophenoxy)-5-chloro-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[6-(4-bromo-3-fluorophenoxy)-5-chloro-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65201433 |
| Molecular Formula | C15H13BrClFN2O |
| Molecular Weight | 371.64 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | N-[[6-(4-bromo-3-fluorophenoxy)-5-chloro-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Oc2ncc(CNC3CC3)cc2Cl)ccc1Br |
| InChI | InChI=1S/C15H13BrClFN2O/c16-12-4-3-11(6-14(12)18)21-15-13(17)5-9(8-20-15)7-19-10-1-2-10/h3-6,8,10,19H,1-2,7H2 |
| InChIKey | HPSJVFPMGXJYTM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |