C16H14Cl2FNO — CID 81151397
N-[[3-chloro-4-(3-chloro-4-fluorophenoxy)phenyl]methyl]cyclopropanamine (PubChem CID 81151397) has the molecular formula C16H14Cl2FNO and a molecular weight of 326.20 g/mol. Its IUPAC name is N-[[3-chloro-4-(3-chloro-4-fluorophenoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-chloro-4-(3-chloro-4-fluorophenoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 81151397 |
| Molecular Formula | C16H14Cl2FNO |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[[3-chloro-4-(3-chloro-4-fluorophenoxy)phenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Oc2ccc(CNC3CC3)cc2Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO/c17-13-8-12(4-5-15(13)19)21-16-6-1-10(7-14(16)18)9-20-11-2-3-11/h1,4-8,11,20H,2-3,9H2 |
| InChIKey | JVZXYHAPDJULLB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |