C16H14BrClFNO — CID 65201184
N-[[2-(4-bromo-3-fluorophenoxy)-6-chlorophenyl]methyl]cyclopropanamine (PubChem CID 65201184) has the molecular formula C16H14BrClFNO and a molecular weight of 370.65 g/mol. Its IUPAC name is N-[[2-(4-bromo-3-fluorophenoxy)-6-chlorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(4-bromo-3-fluorophenoxy)-6-chlorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65201184 |
| Molecular Formula | C16H14BrClFNO |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | N-[[2-(4-bromo-3-fluorophenoxy)-6-chlorophenyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Oc2cccc(Cl)c2CNC2CC2)ccc1Br |
| InChI | InChI=1S/C16H14BrClFNO/c17-13-7-6-11(8-15(13)19)21-16-3-1-2-14(18)12(16)9-20-10-4-5-10/h1-3,6-8,10,20H,4-5,9H2 |
| InChIKey | JSZPGDAGLQXREL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |