C15H14BrFN2O — CID 65201430
N-[[2-(4-bromo-3-fluorophenoxy)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 65201430) has the molecular formula C15H14BrFN2O and a molecular weight of 337.19 g/mol. Its IUPAC name is N-[[2-(4-bromo-3-fluorophenoxy)-3-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(4-bromo-3-fluorophenoxy)-3-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 65201430 |
| Molecular Formula | C15H14BrFN2O |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-[[2-(4-bromo-3-fluorophenoxy)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | Fc1cc(Oc2ncccc2CNC2CC2)ccc1Br |
| InChI | InChI=1S/C15H14BrFN2O/c16-13-6-5-12(8-14(13)17)20-15-10(2-1-7-18-15)9-19-11-3-4-11/h1-2,5-8,11,19H,3-4,9H2 |
| InChIKey | ZLNKXCMJTRGSED-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |