C12H7Cl2F2NO — CID 61269746
3-chloro-5-(chloromethyl)-2-(3,4-difluorophenoxy)pyridine (PubChem CID 61269746) has the molecular formula C12H7Cl2F2NO and a molecular weight of 290.10 g/mol. Its IUPAC name is 3-chloro-5-(chloromethyl)-2-(3,4-difluorophenoxy)pyridine.
| Compound Name | 3-chloro-5-(chloromethyl)-2-(3,4-difluorophenoxy)pyridine |
|---|---|
| PubChem CID | 61269746 |
| Molecular Formula | C12H7Cl2F2NO |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 3-chloro-5-(chloromethyl)-2-(3,4-difluorophenoxy)pyridine |
| SMILES | Fc1ccc(Oc2ncc(CCl)cc2Cl)cc1F |
| InChI | InChI=1S/C12H7Cl2F2NO/c13-5-7-3-9(14)12(17-6-7)18-8-1-2-10(15)11(16)4-8/h1-4,6H,5H2 |
| InChIKey | HWHJCZPTSQLQIL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|