C11H8F2N2O2 — CID 113387914
[2-(3,4-difluorophenoxy)pyrimidin-5-yl]methanol (PubChem CID 113387914) has the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. Its IUPAC name is [2-(3,4-difluorophenoxy)pyrimidin-5-yl]methanol.
| Compound Name | [2-(3,4-difluorophenoxy)pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 113387914 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | [2-(3,4-difluorophenoxy)pyrimidin-5-yl]methanol |
| SMILES | OCc1cnc(Oc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C11H8F2N2O2/c12-9-2-1-8(3-10(9)13)17-11-14-4-7(6-16)5-15-11/h1-5,16H,6H2 |
| InChIKey | CXCCIYDGABMIPP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |