C9H10ClF2NO2S — CID 112676085
2-(3-chloro-2-methylpropyl)sulfonyl-3,5-difluoropyridine (PubChem CID 112676085) has the molecular formula C9H10ClF2NO2S and a molecular weight of 269.70 g/mol. Its IUPAC name is 2-(3-chloro-2-methylpropyl)sulfonyl-3,5-difluoropyridine.
| Compound Name | 2-(3-chloro-2-methylpropyl)sulfonyl-3,5-difluoropyridine |
|---|---|
| PubChem CID | 112676085 |
| Molecular Formula | C9H10ClF2NO2S |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-(3-chloro-2-methylpropyl)sulfonyl-3,5-difluoropyridine |
| SMILES | CC(CCl)CS(=O)(=O)c1ncc(F)cc1F |
| InChI | InChI=1S/C9H10ClF2NO2S/c1-6(3-10)5-16(14,15)9-8(12)2-7(11)4-13-9/h2,4,6H,3,5H2,1H3 |
| InChIKey | KQTIMJAYDYOLEP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|