C10H8ClF5O2S — CID 66103140
1-(3-chloro-2-methylpropyl)sulfonyl-2,3,4,5,6-pentafluorobenzene (PubChem CID 66103140) has the molecular formula C10H8ClF5O2S and a molecular weight of 322.68 g/mol. Its IUPAC name is 1-(3-chloro-2-methylpropyl)sulfonyl-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(3-chloro-2-methylpropyl)sulfonyl-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 66103140 |
| Molecular Formula | C10H8ClF5O2S |
| Molecular Weight | 322.68 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 1-(3-chloro-2-methylpropyl)sulfonyl-2,3,4,5,6-pentafluorobenzene |
| SMILES | CC(CCl)CS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H8ClF5O2S/c1-4(2-11)3-19(17,18)10-8(15)6(13)5(12)7(14)9(10)16/h4H,2-3H2,1H3 |
| InChIKey | LXEVYPRQMNJUKX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|