C15H20FN3 — CID 112679312
1-[4-(2-fluorophenyl)-5-methyl-1H-imidazol-2-yl]-3-methylbutan-1-amine (PubChem CID 112679312) has the molecular formula C15H20FN3 and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)-5-methyl-1H-imidazol-2-yl]-3-methylbutan-1-amine.
| Compound Name | 1-[4-(2-fluorophenyl)-5-methyl-1H-imidazol-2-yl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 112679312 |
| Molecular Formula | C15H20FN3 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-[4-(2-fluorophenyl)-5-methyl-1H-imidazol-2-yl]-3-methylbutan-1-amine |
| SMILES | Cc1[nH]c(C(N)CC(C)C)nc1-c1ccccc1F |
| InChI | InChI=1S/C15H20FN3/c1-9(2)8-13(17)15-18-10(3)14(19-15)11-6-4-5-7-12(11)16/h4-7,9,13H,8,17H2,1-3H3,(H,18,19) |
| InChIKey | KCLPFBNVLMRNKY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |