C19H29NO3Si — CID 11268042
(4S)-4-tert-butyl-3-[(3R)-3-[dimethyl(phenyl)silyl]butanoyl]-1,3-oxazolidin-2-one (PubChem CID 11268042) has the molecular formula C19H29NO3Si and a molecular weight of 347.53 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(3R)-3-[dimethyl(phenyl)silyl]butanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(3R)-3-[dimethyl(phenyl)silyl]butanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11268042 |
| Molecular Formula | C19H29NO3Si |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(3R)-3-[dimethyl(phenyl)silyl]butanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CC(=O)N1C(=O)OC[C@@H]1C(C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H29NO3Si/c1-14(24(5,6)15-10-8-7-9-11-15)12-17(21)20-16(19(2,3)4)13-23-18(20)22/h7-11,14,16H,12-13H2,1-6H3/t14-,16-/m1/s1 |
| InChIKey | WRPPQQLNUOWMQV-GDBMZVCRSA-N |
| XLogP | 3.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|