C25H39NO4Si2 — CID 134875401
(4S)-4-tert-butyl-3-[(E,2S,3S)-5-[dimethyl(phenyl)silyl]-2-ethenyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134875401) has the molecular formula C25H39NO4Si2 and a molecular weight of 473.76 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(E,2S,3S)-5-[dimethyl(phenyl)silyl]-2-ethenyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(E,2S,3S)-5-[dimethyl(phenyl)silyl]-2-ethenyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134875401 |
| Molecular Formula | C25H39NO4Si2 |
| Molecular Weight | 473.76 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(E,2S,3S)-5-[dimethyl(phenyl)silyl]-2-ethenyl-3-trimethylsilyloxypent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H](C(=O)N1C(=O)OC[C@@H]1C(C)(C)C)[C@@H](/C=C/[Si](C)(C)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C25H39NO4Si2/c1-10-20(23(27)26-22(25(2,3)4)18-29-24(26)28)21(30-31(5,6)7)16-17-32(8,9)19-14-12-11-13-15-19/h10-17,20-22H,1,18H2,2-9H3/b17-16+/t20-,21+,22+/m0/s1 |
| InChIKey | FHUJCMKWYGOKGT-WJQFMQRSSA-N |
| XLogP | 5.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.76 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|