C27H41NO4Si — CID 134865995
(4S)-4-benzyl-3-[(2R,3S,4E,6E)-2,4,6-trimethyl-3-triethylsilyloxyocta-4,6-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 134865995) has the molecular formula C27H41NO4Si and a molecular weight of 471.71 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2R,3S,4E,6E)-2,4,6-trimethyl-3-triethylsilyloxyocta-4,6-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2R,3S,4E,6E)-2,4,6-trimethyl-3-triethylsilyloxyocta-4,6-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134865995 |
| Molecular Formula | C27H41NO4Si |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (4S)-4-benzyl-3-[(2R,3S,4E,6E)-2,4,6-trimethyl-3-triethylsilyloxyocta-4,6-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C(C)/C=C(\C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H41NO4Si/c1-8-20(5)17-21(6)25(32-33(9-2,10-3)11-4)22(7)26(29)28-24(19-31-27(28)30)18-23-15-13-12-14-16-23/h8,12-17,22,24-25H,9-11,18-19H2,1-7H3/b20-8+,21-17+/t22-,24+,25-/m1/s1 |
| InChIKey | DICUHAIVUJHFRE-SNISTVFCSA-N |
| XLogP | 6.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|