C18H13Cl2F3N4O2S — CID 1126828
(5S,7S)-3-chloro-N-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1126828) has the molecular formula C18H13Cl2F3N4O2S and a molecular weight of 477.30 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1126828 |
| Molecular Formula | C18H13Cl2F3N4O2S |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | (5S,7S)-3-chloro-N-(5-chloro-2-hydroxyphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)c1nn2c(c1Cl)N[C@H](c1cccs1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C18H13Cl2F3N4O2S/c19-8-3-4-11(28)9(6-8)25-17(29)15-14(20)16-24-10(12-2-1-5-30-12)7-13(18(21,22)23)27(16)26-15/h1-6,10,13,24,28H,7H2,(H,25,29)/t10-,13-/m0/s1 |
| InChIKey | CRZYYTCVZLFJIZ-GWCFXTLKSA-N |
| XLogP | 5.87 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|