C18H12Cl2F4N4OS — CID 1012958
(5S,7S)-3-chloro-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1012958) has the molecular formula C18H12Cl2F4N4OS and a molecular weight of 479.29 g/mol. Its IUPAC name is (5S,7S)-3-chloro-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7S)-3-chloro-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1012958 |
| Molecular Formula | C18H12Cl2F4N4OS |
| Molecular Weight | 479.29 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | (5S,7S)-3-chloro-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1nn2c(c1Cl)N[C@H](c1cccs1)C[C@H]2C(F)(F)F |
| InChI | InChI=1S/C18H12Cl2F4N4OS/c19-9-6-8(3-4-10(9)21)25-17(29)15-14(20)16-26-11(12-2-1-5-30-12)7-13(18(22,23)24)28(16)27-15/h1-6,11,13,26H,7H2,(H,25,29)/t11-,13-/m0/s1 |
| InChIKey | WVUOILZWCFREAG-AAEUAGOBSA-N |
| XLogP | 6.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.29 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |