C18H13ClF4N4OS — CID 1013550
(5R,7R)-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1013550) has the molecular formula C18H13ClF4N4OS and a molecular weight of 444.84 g/mol. Its IUPAC name is (5R,7R)-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1013550 |
| Molecular Formula | C18H13ClF4N4OS |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | (5R,7R)-N-(3-chloro-4-fluorophenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1cccs1)N2 |
| InChI | InChI=1S/C18H13ClF4N4OS/c19-10-6-9(3-4-11(10)20)24-17(28)13-8-16-25-12(14-2-1-5-29-14)7-15(18(21,22)23)27(16)26-13/h1-6,8,12,15,25H,7H2,(H,24,28)/t12-,15-/m1/s1 |
| InChIKey | IEYCDARLMVPTPC-IUODEOHRSA-N |
| XLogP | 5.65 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |