C19H14F6N4OS — CID 1126677
(5S,7S)-5-thiophen-2-yl-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1126677) has the molecular formula C19H14F6N4OS and a molecular weight of 460.40 g/mol. Its IUPAC name is (5S,7S)-5-thiophen-2-yl-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7S)-5-thiophen-2-yl-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1126677 |
| Molecular Formula | C19H14F6N4OS |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (5S,7S)-5-thiophen-2-yl-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1cc2n(n1)[C@H](C(F)(F)F)C[C@@H](c1cccs1)N2 |
| InChI | InChI=1S/C19H14F6N4OS/c20-18(21,22)10-4-1-2-5-11(10)27-17(30)13-9-16-26-12(14-6-3-7-31-14)8-15(19(23,24)25)29(16)28-13/h1-7,9,12,15,26H,8H2,(H,27,30)/t12-,15-/m0/s1 |
| InChIKey | PCJIUEFIPGMTKO-WFASDCNBSA-N |
| XLogP | 5.88 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |