C22H18F6N4O — CID 136853124
(5S,7R)-5-(4-methylphenyl)-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136853124) has the molecular formula C22H18F6N4O and a molecular weight of 468.40 g/mol. Its IUPAC name is (5S,7R)-5-(4-methylphenyl)-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-5-(4-methylphenyl)-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136853124 |
| Molecular Formula | C22H18F6N4O |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (5S,7R)-5-(4-methylphenyl)-7-(trifluoromethyl)-N-[2-(trifluoromethyl)phenyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc([C@@H]2C[C@H](C(F)(F)F)n3nc(C(=O)Nc4ccccc4C(F)(F)F)cc3N2)cc1 |
| InChI | InChI=1S/C22H18F6N4O/c1-12-6-8-13(9-7-12)16-10-18(22(26,27)28)32-19(29-16)11-17(31-32)20(33)30-15-5-3-2-4-14(15)21(23,24)25/h2-9,11,16,18,29H,10H2,1H3,(H,30,33)/t16-,18+/m0/s1 |
| InChIKey | INPGHYFUSZRVJS-FUHWJXTLSA-N |
| XLogP | 6.12 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |