C22H20ClF3N4O — CID 136853436
(5R,7S)-5-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136853436) has the molecular formula C22H20ClF3N4O and a molecular weight of 448.88 g/mol. Its IUPAC name is (5R,7S)-5-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-5-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136853436 |
| Molecular Formula | C22H20ClF3N4O |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (5R,7S)-5-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3n(n2)[C@H](C(F)(F)F)C[C@H](c2ccc(Cl)cc2)N3)c1C |
| InChI | InChI=1S/C22H20ClF3N4O/c1-12-4-3-5-16(13(12)2)28-21(31)18-11-20-27-17(14-6-8-15(23)9-7-14)10-19(22(24,25)26)30(20)29-18/h3-9,11,17,19,27H,10H2,1-2H3,(H,28,31)/t17-,19+/m1/s1 |
| InChIKey | ODJFFUZSLVHOPT-MJGOQNOKSA-N |
| XLogP | 6.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |