C21H17Cl2F3N4O2 — CID 136852944
(5R,7S)-N-(2,5-dichlorophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136852944) has the molecular formula C21H17Cl2F3N4O2 and a molecular weight of 485.29 g/mol. Its IUPAC name is (5R,7S)-N-(2,5-dichlorophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-N-(2,5-dichlorophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136852944 |
| Molecular Formula | C21H17Cl2F3N4O2 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | (5R,7S)-N-(2,5-dichlorophenyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)Nc4cc(Cl)ccc4Cl)cc3N2)cc1 |
| InChI | InChI=1S/C21H17Cl2F3N4O2/c1-32-13-5-2-11(3-6-13)15-9-18(21(24,25)26)30-19(27-15)10-17(29-30)20(31)28-16-8-12(22)4-7-14(16)23/h2-8,10,15,18,27H,9H2,1H3,(H,28,31)/t15-,18+/m1/s1 |
| InChIKey | XEBREBJTDNDQJT-QAPCUYQASA-N |
| XLogP | 6.11 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |