C23H22ClF3N4O4 — CID 1223469
(5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1223469) has the molecular formula C23H22ClF3N4O4 and a molecular weight of 510.90 g/mol. Its IUPAC name is (5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1223469 |
| Molecular Formula | C23H22ClF3N4O4 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc3n(n2)[C@H](C(F)(F)F)C[C@@H](c2ccc(Cl)cc2)N3)cc(OC)c1OC |
| InChI | InChI=1S/C23H22ClF3N4O4/c1-33-17-8-14(9-18(34-2)21(17)35-3)28-22(32)16-11-20-29-15(12-4-6-13(24)7-5-12)10-19(23(25,26)27)31(20)30-16/h4-9,11,15,19,29H,10H2,1-3H3,(H,28,32)/t15-,19-/m0/s1 |
| InChIKey | WZLHRIHUNVCLTQ-KXBFYZLASA-N |
| XLogP | 5.47 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |