C21H21F3N4O5 — CID 1165791
(5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1165791) has the molecular formula C21H21F3N4O5 and a molecular weight of 466.42 g/mol. Its IUPAC name is (5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1165791 |
| Molecular Formula | C21H21F3N4O5 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (5S,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc3n(n2)[C@@H](C(F)(F)F)C[C@@H](c2ccco2)N3)cc(OC)c1OC |
| InChI | InChI=1S/C21H21F3N4O5/c1-30-15-7-11(8-16(31-2)19(15)32-3)25-20(29)13-10-18-26-12(14-5-4-6-33-14)9-17(21(22,23)24)28(18)27-13/h4-8,10,12,17,26H,9H2,1-3H3,(H,25,29)/t12-,17+/m0/s1 |
| InChIKey | KHPKBYYILFXKNF-YVEFUNNKSA-N |
| XLogP | 4.41 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |