C20H17ClF3N5O2 — CID 1256481
(5R,7S)-N-(5-chloro-2-pyridinyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1256481) has the molecular formula C20H17ClF3N5O2 and a molecular weight of 451.84 g/mol. Its IUPAC name is (5R,7S)-N-(5-chloro-2-pyridinyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-N-(5-chloro-2-pyridinyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1256481 |
| Molecular Formula | C20H17ClF3N5O2 |
| Molecular Weight | 451.84 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (5R,7S)-N-(5-chloro-2-pyridinyl)-5-(4-methoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)Nc4ccc(Cl)cn4)cc3N2)cc1 |
| InChI | InChI=1S/C20H17ClF3N5O2/c1-31-13-5-2-11(3-6-13)14-8-16(20(22,23)24)29-18(26-14)9-15(28-29)19(30)27-17-7-4-12(21)10-25-17/h2-7,9-10,14,16,26H,8H2,1H3,(H,25,27,30)/t14-,16+/m1/s1 |
| InChIKey | OWARMSOLIQKIFC-ZBFHGGJFSA-N |
| XLogP | 4.85 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |