C20H18BrF3N4OS — CID 4637427
3-bromo-N-(3,4-dimethylphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 4637427) has the molecular formula C20H18BrF3N4OS and a molecular weight of 499.36 g/mol. Its IUPAC name is 3-bromo-N-(3,4-dimethylphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 3-bromo-N-(3,4-dimethylphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 4637427 |
| Molecular Formula | C20H18BrF3N4OS |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 3-bromo-N-(3,4-dimethylphenyl)-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nn3c(c2Br)NC(c2cccs2)CC3C(F)(F)F)cc1C |
| InChI | InChI=1S/C20H18BrF3N4OS/c1-10-5-6-12(8-11(10)2)25-19(29)17-16(21)18-26-13(14-4-3-7-30-14)9-15(20(22,23)24)28(18)27-17/h3-8,13,15,26H,9H2,1-2H3,(H,25,29) |
| InChIKey | SAUBZRNLZZIXIK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |